C19H19FN4O3 — CID 39642778
methyl 4-[[1-(2-fluorophenyl)-5-pyrrol-1-ylpyrazole-4-carbonyl]amino]butanoate (PubChem CID 39642778) has the molecular formula C19H19FN4O3 and a molecular weight of 370.38 g/mol. Its IUPAC name is methyl 4-[[1-(2-fluorophenyl)-5-pyrrol-1-ylpyrazole-4-carbonyl]amino]butanoate.
| Compound Name | methyl 4-[[1-(2-fluorophenyl)-5-pyrrol-1-ylpyrazole-4-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 39642778 |
| Molecular Formula | C19H19FN4O3 |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | methyl 4-[[1-(2-fluorophenyl)-5-pyrrol-1-ylpyrazole-4-carbonyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)c1cnn(-c2ccccc2F)c1-n1cccc1 |
| InChI | InChI=1S/C19H19FN4O3/c1-27-17(25)9-6-10-21-18(26)14-13-22-24(16-8-3-2-7-15(16)20)19(14)23-11-4-5-12-23/h2-5,7-8,11-13H,6,9-10H2,1H3,(H,21,26) |
| InChIKey | WLYKKOKPANWJNZ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|