C20H14FIN4O — CID 43059370
1-(2-fluorophenyl)-N-(2-iodophenyl)-5-pyrrol-1-ylpyrazole-4-carboxamide (PubChem CID 43059370) has the molecular formula C20H14FIN4O and a molecular weight of 472.26 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-N-(2-iodophenyl)-5-pyrrol-1-ylpyrazole-4-carboxamide.
| Compound Name | 1-(2-fluorophenyl)-N-(2-iodophenyl)-5-pyrrol-1-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 43059370 |
| Molecular Formula | C20H14FIN4O |
| Molecular Weight | 472.26 g/mol |
| Exact Mass | 472.02 |
| IUPAC Name | 1-(2-fluorophenyl)-N-(2-iodophenyl)-5-pyrrol-1-ylpyrazole-4-carboxamide |
| SMILES | O=C(Nc1ccccc1I)c1cnn(-c2ccccc2F)c1-n1cccc1 |
| InChI | InChI=1S/C20H14FIN4O/c21-15-7-1-4-10-18(15)26-20(25-11-5-6-12-25)14(13-23-26)19(27)24-17-9-3-2-8-16(17)22/h1-13H,(H,24,27) |
| InChIKey | QOULMQJMCQFURL-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.26 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|