C23H21FN6O — CID 55580000
1-(2-fluorophenyl)-N-(6-pyrrolidin-1-yl-3-pyridinyl)-5-pyrrol-1-ylpyrazole-4-carboxamide (PubChem CID 55580000) has the molecular formula C23H21FN6O and a molecular weight of 416.46 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-N-(6-pyrrolidin-1-yl-3-pyridinyl)-5-pyrrol-1-ylpyrazole-4-carboxamide.
| Compound Name | 1-(2-fluorophenyl)-N-(6-pyrrolidin-1-yl-3-pyridinyl)-5-pyrrol-1-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55580000 |
| Molecular Formula | C23H21FN6O |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 1-(2-fluorophenyl)-N-(6-pyrrolidin-1-yl-3-pyridinyl)-5-pyrrol-1-ylpyrazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCCC2)nc1)c1cnn(-c2ccccc2F)c1-n1cccc1 |
| InChI | InChI=1S/C23H21FN6O/c24-19-7-1-2-8-20(19)30-23(29-13-5-6-14-29)18(16-26-30)22(31)27-17-9-10-21(25-15-17)28-11-3-4-12-28/h1-2,5-10,13-16H,3-4,11-12H2,(H,27,31) |
| InChIKey | ZERGQZQCZONMAD-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 67.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |