C20H22FN5O2 — CID 39638732
N-[2-(tert-butylamino)-2-oxoethyl]-1-(2-fluorophenyl)-5-pyrrol-1-ylpyrazole-4-carboxamide (PubChem CID 39638732) has the molecular formula C20H22FN5O2 and a molecular weight of 383.43 g/mol. Its IUPAC name is N-[2-(tert-butylamino)-2-oxoethyl]-1-(2-fluorophenyl)-5-pyrrol-1-ylpyrazole-4-carboxamide.
| Compound Name | N-[2-(tert-butylamino)-2-oxoethyl]-1-(2-fluorophenyl)-5-pyrrol-1-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 39638732 |
| Molecular Formula | C20H22FN5O2 |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | N-[2-(tert-butylamino)-2-oxoethyl]-1-(2-fluorophenyl)-5-pyrrol-1-ylpyrazole-4-carboxamide |
| SMILES | CC(C)(C)NC(=O)CNC(=O)c1cnn(-c2ccccc2F)c1-n1cccc1 |
| InChI | InChI=1S/C20H22FN5O2/c1-20(2,3)24-17(27)13-22-18(28)14-12-23-26(16-9-5-4-8-15(16)21)19(14)25-10-6-7-11-25/h4-12H,13H2,1-3H3,(H,22,28)(H,24,27) |
| InChIKey | XBFNZNOHZZIRRE-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |