C19H21FN4O2 — CID 47081624
1-(2-fluorophenyl)-N-(3-methoxypropyl)-N-methyl-5-pyrrol-1-ylpyrazole-4-carboxamide (PubChem CID 47081624) has the molecular formula C19H21FN4O2 and a molecular weight of 356.40 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-N-(3-methoxypropyl)-N-methyl-5-pyrrol-1-ylpyrazole-4-carboxamide.
| Compound Name | 1-(2-fluorophenyl)-N-(3-methoxypropyl)-N-methyl-5-pyrrol-1-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 47081624 |
| Molecular Formula | C19H21FN4O2 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 1-(2-fluorophenyl)-N-(3-methoxypropyl)-N-methyl-5-pyrrol-1-ylpyrazole-4-carboxamide |
| SMILES | COCCCN(C)C(=O)c1cnn(-c2ccccc2F)c1-n1cccc1 |
| InChI | InChI=1S/C19H21FN4O2/c1-22(10-7-13-26-2)19(25)15-14-21-24(17-9-4-3-8-16(17)20)18(15)23-11-5-6-12-23/h3-6,8-9,11-12,14H,7,10,13H2,1-2H3 |
| InChIKey | ILIZGNMJGOPKQE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 52.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|