C12H16ClFN2O2S — CID 122150909
[1-[(2-chloro-5-fluorophenyl)methyl]pyrrolidin-2-yl]methanesulfonamide (PubChem CID 122150909) has the molecular formula C12H16ClFN2O2S and a molecular weight of 306.79 g/mol. Its IUPAC name is [1-[(2-chloro-5-fluorophenyl)methyl]pyrrolidin-2-yl]methanesulfonamide.
| Compound Name | [1-[(2-chloro-5-fluorophenyl)methyl]pyrrolidin-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 122150909 |
| Molecular Formula | C12H16ClFN2O2S |
| Molecular Weight | 306.79 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | [1-[(2-chloro-5-fluorophenyl)methyl]pyrrolidin-2-yl]methanesulfonamide |
| SMILES | NS(=O)(=O)CC1CCCN1Cc1cc(F)ccc1Cl |
| InChI | InChI=1S/C12H16ClFN2O2S/c13-12-4-3-10(14)6-9(12)7-16-5-1-2-11(16)8-19(15,17)18/h3-4,6,11H,1-2,5,7-8H2,(H2,15,17,18) |
| InChIKey | ASWPEEKGXALCCI-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.79 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |