C19H29ClFN3 — CID 99932558
1-[2-[(2R)-1-[(2-chloro-5-fluorophenyl)methyl]piperidin-2-yl]ethyl]-4-methylpiperazine (PubChem CID 99932558) has the molecular formula C19H29ClFN3 and a molecular weight of 353.91 g/mol. Its IUPAC name is 1-[2-[(2R)-1-[(2-chloro-5-fluorophenyl)methyl]piperidin-2-yl]ethyl]-4-methylpiperazine.
| Compound Name | 1-[2-[(2R)-1-[(2-chloro-5-fluorophenyl)methyl]piperidin-2-yl]ethyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 99932558 |
| Molecular Formula | C19H29ClFN3 |
| Molecular Weight | 353.91 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 1-[2-[(2R)-1-[(2-chloro-5-fluorophenyl)methyl]piperidin-2-yl]ethyl]-4-methylpiperazine |
| SMILES | CN1CCN(CC[C@H]2CCCCN2Cc2cc(F)ccc2Cl)CC1 |
| InChI | InChI=1S/C19H29ClFN3/c1-22-10-12-23(13-11-22)9-7-18-4-2-3-8-24(18)15-16-14-17(21)5-6-19(16)20/h5-6,14,18H,2-4,7-13,15H2,1H3/t18-/m1/s1 |
| InChIKey | SXPYTFWRGPCPHF-GOSISDBHSA-N |
| XLogP | 3.47 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.91 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |