C16H15N3O5 — CID 122151264
2-[(E)-2-(5-hydroxy-2-nitrophenyl)ethenyl]-4-propan-2-ylpyrimidine-5-carboxylic acid (PubChem CID 122151264) has the molecular formula C16H15N3O5 and a molecular weight of 329.31 g/mol. Its IUPAC name is 2-[(E)-2-(5-hydroxy-2-nitrophenyl)ethenyl]-4-propan-2-ylpyrimidine-5-carboxylic acid.
| Compound Name | 2-[(E)-2-(5-hydroxy-2-nitrophenyl)ethenyl]-4-propan-2-ylpyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 122151264 |
| Molecular Formula | C16H15N3O5 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 2-[(E)-2-(5-hydroxy-2-nitrophenyl)ethenyl]-4-propan-2-ylpyrimidine-5-carboxylic acid |
| SMILES | CC(C)c1nc(/C=C/c2cc(O)ccc2[N+](=O)[O-])ncc1C(=O)O |
| InChI | InChI=1S/C16H15N3O5/c1-9(2)15-12(16(21)22)8-17-14(18-15)6-3-10-7-11(20)4-5-13(10)19(23)24/h3-9,20H,1-2H3,(H,21,22)/b6-3+ |
| InChIKey | LPKZFJFRDTVNTC-ZZXKWVIFSA-N |
| XLogP | 3.08 |
| TPSA | 126.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|