C16H13N3O2S — CID 122151280
N-(5-acetyl-1,3-thiazol-2-yl)-2-methylquinoline-6-carboxamide (PubChem CID 122151280) has the molecular formula C16H13N3O2S and a molecular weight of 311.37 g/mol. Its IUPAC name is N-(5-acetyl-1,3-thiazol-2-yl)-2-methylquinoline-6-carboxamide.
| Compound Name | N-(5-acetyl-1,3-thiazol-2-yl)-2-methylquinoline-6-carboxamide |
|---|---|
| PubChem CID | 122151280 |
| Molecular Formula | C16H13N3O2S |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | N-(5-acetyl-1,3-thiazol-2-yl)-2-methylquinoline-6-carboxamide |
| SMILES | CC(=O)c1cnc(NC(=O)c2ccc3nc(C)ccc3c2)s1 |
| InChI | InChI=1S/C16H13N3O2S/c1-9-3-4-11-7-12(5-6-13(11)18-9)15(21)19-16-17-8-14(22-16)10(2)20/h3-8H,1-2H3,(H,17,19,21) |
| InChIKey | XFOUTAVYSBSLSG-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |