C19H23N3O3 — CID 122152210
methyl 1-[3-(1-methylpyrazol-4-yl)propanoyl]-4-phenylpyrrolidine-3-carboxylate (PubChem CID 122152210) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is methyl 1-[3-(1-methylpyrazol-4-yl)propanoyl]-4-phenylpyrrolidine-3-carboxylate.
| Compound Name | methyl 1-[3-(1-methylpyrazol-4-yl)propanoyl]-4-phenylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 122152210 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | methyl 1-[3-(1-methylpyrazol-4-yl)propanoyl]-4-phenylpyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1CN(C(=O)CCc2cnn(C)c2)CC1c1ccccc1 |
| InChI | InChI=1S/C19H23N3O3/c1-21-11-14(10-20-21)8-9-18(23)22-12-16(15-6-4-3-5-7-15)17(13-22)19(24)25-2/h3-7,10-11,16-17H,8-9,12-13H2,1-2H3 |
| InChIKey | XACZWVGNLJVBDD-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |