C19H24N4O2 — CID 125143869
(3R)-3-benzyl-4-[3-(1-methylpyrazol-4-yl)propanoyl]-1,4-diazepan-2-one (PubChem CID 125143869) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is (3R)-3-benzyl-4-[3-(1-methylpyrazol-4-yl)propanoyl]-1,4-diazepan-2-one.
| Compound Name | (3R)-3-benzyl-4-[3-(1-methylpyrazol-4-yl)propanoyl]-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 125143869 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | (3R)-3-benzyl-4-[3-(1-methylpyrazol-4-yl)propanoyl]-1,4-diazepan-2-one |
| SMILES | Cn1cc(CCC(=O)N2CCCNC(=O)[C@H]2Cc2ccccc2)cn1 |
| InChI | InChI=1S/C19H24N4O2/c1-22-14-16(13-21-22)8-9-18(24)23-11-5-10-20-19(25)17(23)12-15-6-3-2-4-7-15/h2-4,6-7,13-14,17H,5,8-12H2,1H3,(H,20,25)/t17-/m1/s1 |
| InChIKey | JUKLEJYZQVQXHI-QGZVFWFLSA-N |
| XLogP | 1.31 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |