C17H23N3O4 — CID 122021973
4-[(2-benzyl-3-oxo-1,4-diazepane-1-carbonyl)amino]butanoic acid (PubChem CID 122021973) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is 4-[(2-benzyl-3-oxo-1,4-diazepane-1-carbonyl)amino]butanoic acid.
| Compound Name | 4-[(2-benzyl-3-oxo-1,4-diazepane-1-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 122021973 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 4-[(2-benzyl-3-oxo-1,4-diazepane-1-carbonyl)amino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)N1CCCNC(=O)C1Cc1ccccc1 |
| InChI | InChI=1S/C17H23N3O4/c21-15(22)8-4-9-19-17(24)20-11-5-10-18-16(23)14(20)12-13-6-2-1-3-7-13/h1-3,6-7,14H,4-5,8-12H2,(H,18,23)(H,19,24)(H,21,22) |
| InChIKey | IJLLSJJLQRVSSW-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|