C16H21N5O4 — CID 122152441
2-[[2-(4-nitropyrazol-1-yl)acetyl]amino]adamantane-2-carboxamide (PubChem CID 122152441) has the molecular formula C16H21N5O4 and a molecular weight of 347.38 g/mol. Its IUPAC name is 2-[[2-(4-nitropyrazol-1-yl)acetyl]amino]adamantane-2-carboxamide.
| Compound Name | 2-[[2-(4-nitropyrazol-1-yl)acetyl]amino]adamantane-2-carboxamide |
|---|---|
| PubChem CID | 122152441 |
| Molecular Formula | C16H21N5O4 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 2-[[2-(4-nitropyrazol-1-yl)acetyl]amino]adamantane-2-carboxamide |
| SMILES | NC(=O)C1(NC(=O)Cn2cc([N+](=O)[O-])cn2)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C16H21N5O4/c17-15(23)16(11-2-9-1-10(4-11)5-12(16)3-9)19-14(22)8-20-7-13(6-18-20)21(24)25/h6-7,9-12H,1-5,8H2,(H2,17,23)(H,19,22) |
| InChIKey | GRNDUNPDNOBGKU-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 133.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|