C11H10BrF4NO — CID 122152705
1-[(4-bromo-2,3,5,6-tetrafluorophenyl)methyl]pyrrolidin-3-ol (PubChem CID 122152705) has the molecular formula C11H10BrF4NO and a molecular weight of 328.10 g/mol. Its IUPAC name is 1-[(4-bromo-2,3,5,6-tetrafluorophenyl)methyl]pyrrolidin-3-ol.
| Compound Name | 1-[(4-bromo-2,3,5,6-tetrafluorophenyl)methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 122152705 |
| Molecular Formula | C11H10BrF4NO |
| Molecular Weight | 328.10 g/mol |
| Exact Mass | 326.99 |
| IUPAC Name | 1-[(4-bromo-2,3,5,6-tetrafluorophenyl)methyl]pyrrolidin-3-ol |
| SMILES | OC1CCN(Cc2c(F)c(F)c(Br)c(F)c2F)C1 |
| InChI | InChI=1S/C11H10BrF4NO/c12-7-10(15)8(13)6(9(14)11(7)16)4-17-2-1-5(18)3-17/h5,18H,1-4H2 |
| InChIKey | JAJYADGFBCFIKV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.10 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|