C20H29N3O2 — CID 122153503
2-amino-1-N,3-N-bis(2-cyclopropylethyl)-1-N,3-N-dimethylbenzene-1,3-dicarboxamide (PubChem CID 122153503) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is 2-amino-1-N,3-N-bis(2-cyclopropylethyl)-1-N,3-N-dimethylbenzene-1,3-dicarboxamide.
| Compound Name | 2-amino-1-N,3-N-bis(2-cyclopropylethyl)-1-N,3-N-dimethylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 122153503 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | 2-amino-1-N,3-N-bis(2-cyclopropylethyl)-1-N,3-N-dimethylbenzene-1,3-dicarboxamide |
| SMILES | CN(CCC1CC1)C(=O)c1cccc(C(=O)N(C)CCC2CC2)c1N |
| InChI | InChI=1S/C20H29N3O2/c1-22(12-10-14-6-7-14)19(24)16-4-3-5-17(18(16)21)20(25)23(2)13-11-15-8-9-15/h3-5,14-15H,6-13,21H2,1-2H3 |
| InChIKey | KIMUBTBEWZQCKA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|