C17H32N4O2 — CID 122154247
1-(4-methylpiperazin-1-yl)-3-(3-morpholin-4-ylpiperidin-1-yl)propan-1-one (PubChem CID 122154247) has the molecular formula C17H32N4O2 and a molecular weight of 324.47 g/mol. Its IUPAC name is 1-(4-methylpiperazin-1-yl)-3-(3-morpholin-4-ylpiperidin-1-yl)propan-1-one.
| Compound Name | 1-(4-methylpiperazin-1-yl)-3-(3-morpholin-4-ylpiperidin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 122154247 |
| Molecular Formula | C17H32N4O2 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | 1-(4-methylpiperazin-1-yl)-3-(3-morpholin-4-ylpiperidin-1-yl)propan-1-one |
| SMILES | CN1CCN(C(=O)CCN2CCCC(N3CCOCC3)C2)CC1 |
| InChI | InChI=1S/C17H32N4O2/c1-18-7-9-21(10-8-18)17(22)4-6-19-5-2-3-16(15-19)20-11-13-23-14-12-20/h16H,2-15H2,1H3 |
| InChIKey | LJKUGKZXICYUPN-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 39.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |