C18H24N2O3 — CID 122154671
tert-butyl (3S,4S)-3-hydroxy-4-[methyl(prop-2-ynyl)amino]-3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 122154671) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is tert-butyl (3S,4S)-3-hydroxy-4-[methyl(prop-2-ynyl)amino]-3,4-dihydro-2H-quinoline-1-carboxylate.
| Compound Name | tert-butyl (3S,4S)-3-hydroxy-4-[methyl(prop-2-ynyl)amino]-3,4-dihydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 122154671 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | tert-butyl (3S,4S)-3-hydroxy-4-[methyl(prop-2-ynyl)amino]-3,4-dihydro-2H-quinoline-1-carboxylate |
| SMILES | C#CCN(C)[C@H]1c2ccccc2N(C(=O)OC(C)(C)C)C[C@@H]1O |
| InChI | InChI=1S/C18H24N2O3/c1-6-11-19(5)16-13-9-7-8-10-14(13)20(12-15(16)21)17(22)23-18(2,3)4/h1,7-10,15-16,21H,11-12H2,2-5H3/t15-,16-/m0/s1 |
| InChIKey | SNZIDGWMHDFYOD-HOTGVXAUSA-N |
| XLogP | 2.41 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|