C14H17ClN4 — CID 122154672
4-chloro-N-(1-methylpiperidin-4-yl)-1,5-naphthyridin-2-amine (PubChem CID 122154672) has the molecular formula C14H17ClN4 and a molecular weight of 276.77 g/mol. Its IUPAC name is 4-chloro-N-(1-methylpiperidin-4-yl)-1,5-naphthyridin-2-amine.
| Compound Name | 4-chloro-N-(1-methylpiperidin-4-yl)-1,5-naphthyridin-2-amine |
|---|---|
| PubChem CID | 122154672 |
| Molecular Formula | C14H17ClN4 |
| Molecular Weight | 276.77 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 4-chloro-N-(1-methylpiperidin-4-yl)-1,5-naphthyridin-2-amine |
| SMILES | CN1CCC(Nc2cc(Cl)c3ncccc3n2)CC1 |
| InChI | InChI=1S/C14H17ClN4/c1-19-7-4-10(5-8-19)17-13-9-11(15)14-12(18-13)3-2-6-16-14/h2-3,6,9-10H,4-5,7-8H2,1H3,(H,17,18) |
| InChIKey | NWLPXOIQEYNATI-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.77 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |