C18H29ClN2O3 — CID 122155424
[3-(dimethylcarbamoyl)phenyl]methyl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride (PubChem CID 122155424) has the molecular formula C18H29ClN2O3 and a molecular weight of 356.89 g/mol. Its IUPAC name is [3-(dimethylcarbamoyl)phenyl]methyl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride.
| Compound Name | [3-(dimethylcarbamoyl)phenyl]methyl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride |
|---|---|
| PubChem CID | 122155424 |
| Molecular Formula | C18H29ClN2O3 |
| Molecular Weight | 356.89 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | [3-(dimethylcarbamoyl)phenyl]methyl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride |
| SMILES | CC(C)C[C@H](CN)CC(=O)OCc1cccc(C(=O)N(C)C)c1.Cl |
| InChI | InChI=1S/C18H28N2O3.ClH/c1-13(2)8-15(11-19)10-17(21)23-12-14-6-5-7-16(9-14)18(22)20(3)4;/h5-7,9,13,15H,8,10-12,19H2,1-4H3;1H/t15-;/m0./s1 |
| InChIKey | YJNFXTRMWMMJPF-RSAXXLAASA-N |
| XLogP | 2.86 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.89 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |