C12H15F3N2O4S — CID 122157965
methyl 2-[methylsulfamoyl-[[4-(trifluoromethyl)phenyl]methyl]amino]acetate (PubChem CID 122157965) has the molecular formula C12H15F3N2O4S and a molecular weight of 340.32 g/mol. Its IUPAC name is methyl 2-[methylsulfamoyl-[[4-(trifluoromethyl)phenyl]methyl]amino]acetate.
| Compound Name | methyl 2-[methylsulfamoyl-[[4-(trifluoromethyl)phenyl]methyl]amino]acetate |
|---|---|
| PubChem CID | 122157965 |
| Molecular Formula | C12H15F3N2O4S |
| Molecular Weight | 340.32 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | methyl 2-[methylsulfamoyl-[[4-(trifluoromethyl)phenyl]methyl]amino]acetate |
| SMILES | CNS(=O)(=O)N(CC(=O)OC)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H15F3N2O4S/c1-16-22(19,20)17(8-11(18)21-2)7-9-3-5-10(6-4-9)12(13,14)15/h3-6,16H,7-8H2,1-2H3 |
| InChIKey | VPJYHYKVOVOGRF-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.32 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |