C13H12N4OS — CID 122159004
3-ethyl-5-(3-pyrazol-1-ylphenoxy)-1,2,4-thiadiazole (PubChem CID 122159004) has the molecular formula C13H12N4OS and a molecular weight of 272.33 g/mol. Its IUPAC name is 3-ethyl-5-(3-pyrazol-1-ylphenoxy)-1,2,4-thiadiazole.
| Compound Name | 3-ethyl-5-(3-pyrazol-1-ylphenoxy)-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 122159004 |
| Molecular Formula | C13H12N4OS |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 3-ethyl-5-(3-pyrazol-1-ylphenoxy)-1,2,4-thiadiazole |
| SMILES | CCc1nsc(Oc2cccc(-n3cccn3)c2)n1 |
| InChI | InChI=1S/C13H12N4OS/c1-2-12-15-13(19-16-12)18-11-6-3-5-10(9-11)17-8-4-7-14-17/h3-9H,2H2,1H3 |
| InChIKey | KQJFBKRAJKTXMV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |