C18H21N3O2S — CID 122159584
3-[(2-tert-butylsulfanylacetyl)amino]-N-pyridin-4-ylbenzamide (PubChem CID 122159584) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is 3-[(2-tert-butylsulfanylacetyl)amino]-N-pyridin-4-ylbenzamide.
| Compound Name | 3-[(2-tert-butylsulfanylacetyl)amino]-N-pyridin-4-ylbenzamide |
|---|---|
| PubChem CID | 122159584 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 3-[(2-tert-butylsulfanylacetyl)amino]-N-pyridin-4-ylbenzamide |
| SMILES | CC(C)(C)SCC(=O)Nc1cccc(C(=O)Nc2ccncc2)c1 |
| InChI | InChI=1S/C18H21N3O2S/c1-18(2,3)24-12-16(22)20-15-6-4-5-13(11-15)17(23)21-14-7-9-19-10-8-14/h4-11H,12H2,1-3H3,(H,20,22)(H,19,21,23) |
| InChIKey | MPIBXTQMJFJXPF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |