C17H18F3NO2S — CID 122160193
N-(5-hydroxy-3-thiophen-2-ylpentyl)-2-(trifluoromethyl)benzamide (PubChem CID 122160193) has the molecular formula C17H18F3NO2S and a molecular weight of 357.40 g/mol. Its IUPAC name is N-(5-hydroxy-3-thiophen-2-ylpentyl)-2-(trifluoromethyl)benzamide.
| Compound Name | N-(5-hydroxy-3-thiophen-2-ylpentyl)-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 122160193 |
| Molecular Formula | C17H18F3NO2S |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | N-(5-hydroxy-3-thiophen-2-ylpentyl)-2-(trifluoromethyl)benzamide |
| SMILES | O=C(NCCC(CCO)c1cccs1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C17H18F3NO2S/c18-17(19,20)14-5-2-1-4-13(14)16(23)21-9-7-12(8-10-22)15-6-3-11-24-15/h1-6,11-12,22H,7-10H2,(H,21,23) |
| InChIKey | RBRGHYQWCFVOSI-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |