C15H15Cl2N3O3S — CID 122160912
4-[1-(2,4-dichloro-5-methylphenyl)sulfonylpyrrolidin-3-yl]oxypyrimidine (PubChem CID 122160912) has the molecular formula C15H15Cl2N3O3S and a molecular weight of 388.28 g/mol. Its IUPAC name is 4-[1-(2,4-dichloro-5-methylphenyl)sulfonylpyrrolidin-3-yl]oxypyrimidine.
| Compound Name | 4-[1-(2,4-dichloro-5-methylphenyl)sulfonylpyrrolidin-3-yl]oxypyrimidine |
|---|---|
| PubChem CID | 122160912 |
| Molecular Formula | C15H15Cl2N3O3S |
| Molecular Weight | 388.28 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | 4-[1-(2,4-dichloro-5-methylphenyl)sulfonylpyrrolidin-3-yl]oxypyrimidine |
| SMILES | Cc1cc(S(=O)(=O)N2CCC(Oc3ccncn3)C2)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H15Cl2N3O3S/c1-10-6-14(13(17)7-12(10)16)24(21,22)20-5-3-11(8-20)23-15-2-4-18-9-19-15/h2,4,6-7,9,11H,3,5,8H2,1H3 |
| InChIKey | ZQOIOKRHGKTRMS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.28 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |