C16H20N2O3 — CID 122162082
(6-cyclopentyloxy-3-pyridinyl)-(2-oxa-5-azabicyclo[2.2.1]heptan-5-yl)methanone (PubChem CID 122162082) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is (6-cyclopentyloxy-3-pyridinyl)-(2-oxa-5-azabicyclo[2.2.1]heptan-5-yl)methanone.
| Compound Name | (6-cyclopentyloxy-3-pyridinyl)-(2-oxa-5-azabicyclo[2.2.1]heptan-5-yl)methanone |
|---|---|
| PubChem CID | 122162082 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | (6-cyclopentyloxy-3-pyridinyl)-(2-oxa-5-azabicyclo[2.2.1]heptan-5-yl)methanone |
| SMILES | O=C(c1ccc(OC2CCCC2)nc1)N1CC2CC1CO2 |
| InChI | InChI=1S/C16H20N2O3/c19-16(18-9-14-7-12(18)10-20-14)11-5-6-15(17-8-11)21-13-3-1-2-4-13/h5-6,8,12-14H,1-4,7,9-10H2 |
| InChIKey | RNGXMDHMZRGAJB-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |