C20H24N4O2S — CID 154830749
(6-cyclopentyloxy-3-pyridinyl)-[2-(1,3-thiazol-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone (PubChem CID 154830749) has the molecular formula C20H24N4O2S and a molecular weight of 384.51 g/mol. Its IUPAC name is (6-cyclopentyloxy-3-pyridinyl)-[2-(1,3-thiazol-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone.
| Compound Name | (6-cyclopentyloxy-3-pyridinyl)-[2-(1,3-thiazol-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
|---|---|
| PubChem CID | 154830749 |
| Molecular Formula | C20H24N4O2S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | (6-cyclopentyloxy-3-pyridinyl)-[2-(1,3-thiazol-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
| SMILES | O=C(c1ccc(OC2CCCC2)nc1)N1CC2CN(c3nccs3)CC2C1 |
| InChI | InChI=1S/C20H24N4O2S/c25-19(14-5-6-18(22-9-14)26-17-3-1-2-4-17)23-10-15-12-24(13-16(15)11-23)20-21-7-8-27-20/h5-9,15-17H,1-4,10-13H2 |
| InChIKey | IVURSGJKBFKOPL-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |