C20H29O4- — CID 122164883
(5Z,13E,15S)-15-hydroxy-9-oxoprosta-5,11,13-trien-1-oate (PubChem CID 122164883) has the molecular formula C20H29O4- and a molecular weight of 333.40 g/mol. Its IUPAC name is (Z)-7-[(1R)-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopent-2-en-1-yl]hept-5-enoate.
| Compound Name | (5Z,13E,15S)-15-hydroxy-9-oxoprosta-5,11,13-trien-1-oate |
|---|---|
| PubChem CID | 122164883 |
| Molecular Formula | C20H29O4- |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | (Z)-7-[(1R)-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopent-2-en-1-yl]hept-5-enoate |
| SMILES | CCCCC[C@@H](/C=C/C1=CCC(=O)[C@@H]1C/C=C\CCCC(=O)[O-])O |
| InChI | InChI=1S/C20H30O4/c1-2-3-6-9-17(21)14-12-16-13-15-19(22)18(16)10-7-4-5-8-11-20(23)24/h4,7,12-14,17-18,21H,2-3,5-6,8-11,15H2,1H3,(H,23,24)/p-1/b7-4-,14-12+/t17-,18+/m0/s1 |
| InChIKey | CMBOTAQMTNMTBD-KLASNZEFSA-M |
| XLogP | 3.90 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | 482 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|