C17H28O3 — CID 5312765
12-Hydroxy-5,8,10-heptadecatrienoic acid (PubChem CID 5312765) has the molecular formula C17H28O3 and a molecular weight of 280.40 g/mol. Its IUPAC name is (5E,8E,10E)-12-hydroxyheptadeca-5,8,10-trienoic acid.
| Compound Name | 12-Hydroxy-5,8,10-heptadecatrienoic acid |
|---|---|
| PubChem CID | 5312765 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | (5E,8E,10E)-12-hydroxyheptadeca-5,8,10-trienoic acid |
| SMILES | CCCCCC(/C=C/C=C/C/C=C/CCCC(=O)O)O |
| InChI | InChI=1S/C17H28O3/c1-2-3-10-13-16(18)14-11-8-6-4-5-7-9-12-15-17(19)20/h5-8,11,14,16,18H,2-4,9-10,12-13,15H2,1H3,(H,19,20)/b7-5+,8-6+,14-11+ |
| InChIKey | KUKJHGXXZWHSBG-GMPNNLDHSA-N |
| XLogP | 4.10 |
| TPSA | 57.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | 316 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|