C30H36FN3O4 — CID 122165546
(14Z,16S,17S)-4-[(4-fluorophenyl)methyl]-17-[2-[(3R)-3-hydroxypyrrolidin-1-yl]-2-oxoethyl]-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6,8,10,14-tetraen-2-one (PubChem CID 122165546) has the molecular formula C30H36FN3O4 and a molecular weight of 521.63 g/mol. Its IUPAC name is (14Z,16S,17S)-4-[(4-fluorophenyl)methyl]-17-[2-[(3R)-3-hydroxypyrrolidin-1-yl]-2-oxoethyl]-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6,8,10,14-tetraen-2-one.
| Compound Name | (14Z,16S,17S)-4-[(4-fluorophenyl)methyl]-17-[2-[(3R)-3-hydroxypyrrolidin-1-yl]-2-oxoethyl]-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6,8,10,14-tetraen-2-one |
|---|---|
| PubChem CID | 122165546 |
| Molecular Formula | C30H36FN3O4 |
| Molecular Weight | 521.63 g/mol |
| Exact Mass | 521.27 |
| IUPAC Name | (14Z,16S,17S)-4-[(4-fluorophenyl)methyl]-17-[2-[(3R)-3-hydroxypyrrolidin-1-yl]-2-oxoethyl]-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6,8,10,14-tetraen-2-one |
| SMILES | O=C(C[C@@H]1CCN2C[C@@H]1/C=C\COc1ccccc1CN(Cc1ccc(F)cc1)CC2=O)N1CC[C@@H](O)C1 |
| InChI | InChI=1S/C30H36FN3O4/c31-26-9-7-22(8-10-26)17-32-18-25-4-1-2-6-28(25)38-15-3-5-24-19-33(30(37)21-32)13-11-23(24)16-29(36)34-14-12-27(35)20-34/h1-10,23-24,27,35H,11-21H2/b5-3-/t23-,24-,27+/m0/s1 |
| InChIKey | QTWIPACFFYKREC-LMBMUJHMSA-N |
| XLogP | 3.22 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.63 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|