C28H41N3O4 — CID 122165549
(14Z,16S,17S)-4-(2,2-dimethylpropyl)-17-[2-[(3R)-3-hydroxypyrrolidin-1-yl]-2-oxoethyl]-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6,8,10,14-tetraen-2-one (PubChem CID 122165549) has the molecular formula C28H41N3O4 and a molecular weight of 483.65 g/mol. Its IUPAC name is (14Z,16S,17S)-4-(2,2-dimethylpropyl)-17-[2-[(3R)-3-hydroxypyrrolidin-1-yl]-2-oxoethyl]-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6,8,10,14-tetraen-2-one.
| Compound Name | (14Z,16S,17S)-4-(2,2-dimethylpropyl)-17-[2-[(3R)-3-hydroxypyrrolidin-1-yl]-2-oxoethyl]-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6,8,10,14-tetraen-2-one |
|---|---|
| PubChem CID | 122165549 |
| Molecular Formula | C28H41N3O4 |
| Molecular Weight | 483.65 g/mol |
| Exact Mass | 483.31 |
| IUPAC Name | (14Z,16S,17S)-4-(2,2-dimethylpropyl)-17-[2-[(3R)-3-hydroxypyrrolidin-1-yl]-2-oxoethyl]-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6,8,10,14-tetraen-2-one |
| SMILES | CC(C)(C)CN1CC(=O)N2CC[C@@H](CC(=O)N3CC[C@@H](O)C3)[C@@H](/C=C\COc3ccccc3C1)C2 |
| InChI | InChI=1S/C28H41N3O4/c1-28(2,3)20-29-16-23-7-4-5-9-25(23)35-14-6-8-22-17-30(27(34)19-29)12-10-21(22)15-26(33)31-13-11-24(32)18-31/h4-9,21-22,24,32H,10-20H2,1-3H3/b8-6-/t21-,22-,24+/m0/s1 |
| InChIKey | RCCUDXFVRXNDHH-RWJYYPQGSA-N |
| XLogP | 2.93 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.65 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|