C13H14FNS — CID 122165798
N-[(5-fluorothiophen-2-yl)methyl]-1-(4-methylphenyl)methanamine (PubChem CID 122165798) has the molecular formula C13H14FNS and a molecular weight of 235.33 g/mol. Its IUPAC name is N-[(5-fluorothiophen-2-yl)methyl]-1-(4-methylphenyl)methanamine.
| Compound Name | N-[(5-fluorothiophen-2-yl)methyl]-1-(4-methylphenyl)methanamine |
|---|---|
| PubChem CID | 122165798 |
| Molecular Formula | C13H14FNS |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | N-[(5-fluorothiophen-2-yl)methyl]-1-(4-methylphenyl)methanamine |
| SMILES | Cc1ccc(CNCc2ccc(F)s2)cc1 |
| InChI | InChI=1S/C13H14FNS/c1-10-2-4-11(5-3-10)8-15-9-12-6-7-13(14)16-12/h2-7,15H,8-9H2,1H3 |
| InChIKey | NRYUWKYEYPAUOG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |