C11H15ClFN3S — CID 126963998
1-(2-ethylpyrazol-3-yl)-N-[(5-fluorothiophen-2-yl)methyl]methanamine;hydrochloride (PubChem CID 126963998) has the molecular formula C11H15ClFN3S and a molecular weight of 275.78 g/mol. Its IUPAC name is 1-(2-ethylpyrazol-3-yl)-N-[(5-fluorothiophen-2-yl)methyl]methanamine;hydrochloride.
| Compound Name | 1-(2-ethylpyrazol-3-yl)-N-[(5-fluorothiophen-2-yl)methyl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 126963998 |
| Molecular Formula | C11H15ClFN3S |
| Molecular Weight | 275.78 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 1-(2-ethylpyrazol-3-yl)-N-[(5-fluorothiophen-2-yl)methyl]methanamine;hydrochloride |
| SMILES | CCn1nccc1CNCc1ccc(F)s1.Cl |
| InChI | InChI=1S/C11H14FN3S.ClH/c1-2-15-9(5-6-14-15)7-13-8-10-3-4-11(12)16-10;/h3-6,13H,2,7-8H2,1H3;1H |
| InChIKey | WYOBLXMQYOBVQE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.78 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |