C14H18FN3 — CID 122165910
N-[(1-ethyl-5-fluoropyrazol-4-yl)methyl]-2-phenylethanamine (PubChem CID 122165910) has the molecular formula C14H18FN3 and a molecular weight of 247.32 g/mol. Its IUPAC name is N-[(1-ethyl-5-fluoropyrazol-4-yl)methyl]-2-phenylethanamine.
| Compound Name | N-[(1-ethyl-5-fluoropyrazol-4-yl)methyl]-2-phenylethanamine |
|---|---|
| PubChem CID | 122165910 |
| Molecular Formula | C14H18FN3 |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | N-[(1-ethyl-5-fluoropyrazol-4-yl)methyl]-2-phenylethanamine |
| SMILES | CCn1ncc(CNCCc2ccccc2)c1F |
| InChI | InChI=1S/C14H18FN3/c1-2-18-14(15)13(11-17-18)10-16-9-8-12-6-4-3-5-7-12/h3-7,11,16H,2,8-10H2,1H3 |
| InChIKey | XFCCWVNOGZJLCD-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|