C10H13F2N5 — CID 122166559
1-(difluoromethyl)-3-methyl-N-[(1-methylpyrazol-3-yl)methyl]pyrazol-4-amine (PubChem CID 122166559) has the molecular formula C10H13F2N5 and a molecular weight of 241.25 g/mol. Its IUPAC name is 1-(difluoromethyl)-3-methyl-N-[(1-methylpyrazol-3-yl)methyl]pyrazol-4-amine.
| Compound Name | 1-(difluoromethyl)-3-methyl-N-[(1-methylpyrazol-3-yl)methyl]pyrazol-4-amine |
|---|---|
| PubChem CID | 122166559 |
| Molecular Formula | C10H13F2N5 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 1-(difluoromethyl)-3-methyl-N-[(1-methylpyrazol-3-yl)methyl]pyrazol-4-amine |
| SMILES | Cc1nn(C(F)F)cc1NCc1ccn(C)n1 |
| InChI | InChI=1S/C10H13F2N5/c1-7-9(6-17(14-7)10(11)12)13-5-8-3-4-16(2)15-8/h3-4,6,10,13H,5H2,1-2H3 |
| InChIKey | ADMODBMNPYYASS-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |