C11H14FN3S — CID 122168698
1-(2-fluoroethyl)-3-methyl-N-(thiophen-2-ylmethyl)pyrazol-4-amine (PubChem CID 122168698) has the molecular formula C11H14FN3S and a molecular weight of 239.32 g/mol. Its IUPAC name is 1-(2-fluoroethyl)-3-methyl-N-(thiophen-2-ylmethyl)pyrazol-4-amine.
| Compound Name | 1-(2-fluoroethyl)-3-methyl-N-(thiophen-2-ylmethyl)pyrazol-4-amine |
|---|---|
| PubChem CID | 122168698 |
| Molecular Formula | C11H14FN3S |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 1-(2-fluoroethyl)-3-methyl-N-(thiophen-2-ylmethyl)pyrazol-4-amine |
| SMILES | Cc1nn(CCF)cc1NCc1cccs1 |
| InChI | InChI=1S/C11H14FN3S/c1-9-11(8-15(14-9)5-4-12)13-7-10-3-2-6-16-10/h2-3,6,8,13H,4-5,7H2,1H3 |
| InChIKey | WGPYXNAPNUSAFQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |