C9H8F3N3S — CID 155893904
1-methyl-5-thiophen-2-yl-3-(trifluoromethyl)pyrazol-4-amine (PubChem CID 155893904) has the molecular formula C9H8F3N3S and a molecular weight of 247.25 g/mol. Its IUPAC name is 1-methyl-5-thiophen-2-yl-3-(trifluoromethyl)pyrazol-4-amine.
| Compound Name | 1-methyl-5-thiophen-2-yl-3-(trifluoromethyl)pyrazol-4-amine |
|---|---|
| PubChem CID | 155893904 |
| Molecular Formula | C9H8F3N3S |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 1-methyl-5-thiophen-2-yl-3-(trifluoromethyl)pyrazol-4-amine |
| SMILES | Cn1nc(C(F)(F)F)c(N)c1-c1cccs1 |
| InChI | InChI=1S/C9H8F3N3S/c1-15-7(5-3-2-4-16-5)6(13)8(14-15)9(10,11)12/h2-4H,13H2,1H3 |
| InChIKey | QWIQMNDIFOHLOS-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |