C10H9N5OS — CID 53248758
cyanoimino-(1,3-dimethyl-5-thiophen-2-ylpyrazol-4-yl)-oxidoazanium (PubChem CID 53248758) has the molecular formula C10H9N5OS and a molecular weight of 247.28 g/mol. Its IUPAC name is cyanoimino-(1,3-dimethyl-5-thiophen-2-ylpyrazol-4-yl)-oxidoazanium.
| Compound Name | cyanoimino-(1,3-dimethyl-5-thiophen-2-ylpyrazol-4-yl)-oxidoazanium |
|---|---|
| PubChem CID | 53248758 |
| Molecular Formula | C10H9N5OS |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | cyanoimino-(1,3-dimethyl-5-thiophen-2-ylpyrazol-4-yl)-oxidoazanium |
| SMILES | Cc1nn(C)c(-c2cccs2)c1/[N+]([O-])=N/C#N |
| InChI | InChI=1S/C10H9N5OS/c1-7-9(15(16)12-6-11)10(14(2)13-7)8-4-3-5-17-8/h3-5H,1-2H3/b15-12- |
| InChIKey | FSDFEIYUTNUOFD-QINSGFPZSA-N |
| XLogP | 2.53 |
| TPSA | 80.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|