C10H11N5O2S — CID 54585788
(Z)-carbamoylimino-(1,5-dimethyl-3-thiophen-2-ylpyrazol-4-yl)-oxidoazanium (PubChem CID 54585788) has the molecular formula C10H11N5O2S and a molecular weight of 265.30 g/mol. Its IUPAC name is (Z)-carbamoylimino-(1,5-dimethyl-3-thiophen-2-ylpyrazol-4-yl)-oxidoazanium.
| Compound Name | (Z)-carbamoylimino-(1,5-dimethyl-3-thiophen-2-ylpyrazol-4-yl)-oxidoazanium |
|---|---|
| PubChem CID | 54585788 |
| Molecular Formula | C10H11N5O2S |
| Molecular Weight | 265.30 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | (Z)-carbamoylimino-(1,5-dimethyl-3-thiophen-2-ylpyrazol-4-yl)-oxidoazanium |
| SMILES | Cc1c(/[N+]([O-])=N/C(N)=O)c(-c2cccs2)nn1C |
| InChI | InChI=1S/C10H11N5O2S/c1-6-9(15(17)13-10(11)16)8(12-14(6)2)7-4-3-5-18-7/h3-5H,1-2H3,(H2,11,16)/b15-13- |
| InChIKey | IOPDUMRQJDYZNU-SQFISAMPSA-N |
| XLogP | 2.13 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|