C9H15F2N3 — CID 122168967
N-[[1-(difluoromethyl)pyrazol-3-yl]methyl]butan-1-amine (PubChem CID 122168967) has the molecular formula C9H15F2N3 and a molecular weight of 203.24 g/mol. Its IUPAC name is N-[[1-(difluoromethyl)pyrazol-3-yl]methyl]butan-1-amine.
| Compound Name | N-[[1-(difluoromethyl)pyrazol-3-yl]methyl]butan-1-amine |
|---|---|
| PubChem CID | 122168967 |
| Molecular Formula | C9H15F2N3 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | N-[[1-(difluoromethyl)pyrazol-3-yl]methyl]butan-1-amine |
| SMILES | CCCCNCc1ccn(C(F)F)n1 |
| InChI | InChI=1S/C9H15F2N3/c1-2-3-5-12-7-8-4-6-14(13-8)9(10)11/h4,6,9,12H,2-3,5,7H2,1H3 |
| InChIKey | KXONCTPSLWUYAU-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|