C7H8ClF2N3O — CID 166429258
2-chloro-N-[[1-(difluoromethyl)pyrazol-3-yl]methyl]acetamide (PubChem CID 166429258) has the molecular formula C7H8ClF2N3O and a molecular weight of 223.61 g/mol. Its IUPAC name is 2-chloro-N-[[1-(difluoromethyl)pyrazol-3-yl]methyl]acetamide.
| Compound Name | 2-chloro-N-[[1-(difluoromethyl)pyrazol-3-yl]methyl]acetamide |
|---|---|
| PubChem CID | 166429258 |
| Molecular Formula | C7H8ClF2N3O |
| Molecular Weight | 223.61 g/mol |
| Exact Mass | 223.03 |
| IUPAC Name | 2-chloro-N-[[1-(difluoromethyl)pyrazol-3-yl]methyl]acetamide |
| SMILES | O=C(CCl)NCc1ccn(C(F)F)n1 |
| InChI | InChI=1S/C7H8ClF2N3O/c8-3-6(14)11-4-5-1-2-13(12-5)7(9)10/h1-2,7H,3-4H2,(H,11,14) |
| InChIKey | VMLANDJATXKNMU-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.61 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|