C14H26N4O — CID 122171333
3-amino-1-ethyl-N,N-bis(2-methylpropyl)pyrazole-5-carboxamide (PubChem CID 122171333) has the molecular formula C14H26N4O and a molecular weight of 266.39 g/mol. Its IUPAC name is 3-amino-1-ethyl-N,N-bis(2-methylpropyl)pyrazole-5-carboxamide.
| Compound Name | 3-amino-1-ethyl-N,N-bis(2-methylpropyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 122171333 |
| Molecular Formula | C14H26N4O |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | 3-amino-1-ethyl-N,N-bis(2-methylpropyl)pyrazole-5-carboxamide |
| SMILES | CCn1nc(N)cc1C(=O)N(CC(C)C)CC(C)C |
| InChI | InChI=1S/C14H26N4O/c1-6-18-12(7-13(15)16-18)14(19)17(8-10(2)3)9-11(4)5/h7,10-11H,6,8-9H2,1-5H3,(H2,15,16) |
| InChIKey | CKWZCCKFMOYJEZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |