C17H23FN4O2 — CID 138995809
3-ethyl-N-[2-(4-fluorophenyl)-2-hydroxyethyl]-N-(2-methylpropyl)triazole-4-carboxamide (PubChem CID 138995809) has the molecular formula C17H23FN4O2 and a molecular weight of 334.40 g/mol. Its IUPAC name is 3-ethyl-N-[2-(4-fluorophenyl)-2-hydroxyethyl]-N-(2-methylpropyl)triazole-4-carboxamide.
| Compound Name | 3-ethyl-N-[2-(4-fluorophenyl)-2-hydroxyethyl]-N-(2-methylpropyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 138995809 |
| Molecular Formula | C17H23FN4O2 |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 3-ethyl-N-[2-(4-fluorophenyl)-2-hydroxyethyl]-N-(2-methylpropyl)triazole-4-carboxamide |
| SMILES | CCn1nncc1C(=O)N(CC(C)C)CC(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H23FN4O2/c1-4-22-15(9-19-20-22)17(24)21(10-12(2)3)11-16(23)13-5-7-14(18)8-6-13/h5-9,12,16,23H,4,10-11H2,1-3H3 |
| InChIKey | IBPSGVNUMFQLMY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |