C21H28FN3O4 — CID 95772315
1-[(2S)-2-(4-fluorophenyl)-2-hydroxyethyl]-3-[6-(2-methoxyethoxy)-3-pyridinyl]-1-(2-methylpropyl)urea (PubChem CID 95772315) has the molecular formula C21H28FN3O4 and a molecular weight of 405.47 g/mol. Its IUPAC name is 1-[(2S)-2-(4-fluorophenyl)-2-hydroxyethyl]-3-[6-(2-methoxyethoxy)-3-pyridinyl]-1-(2-methylpropyl)urea.
| Compound Name | 1-[(2S)-2-(4-fluorophenyl)-2-hydroxyethyl]-3-[6-(2-methoxyethoxy)-3-pyridinyl]-1-(2-methylpropyl)urea |
|---|---|
| PubChem CID | 95772315 |
| Molecular Formula | C21H28FN3O4 |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 1-[(2S)-2-(4-fluorophenyl)-2-hydroxyethyl]-3-[6-(2-methoxyethoxy)-3-pyridinyl]-1-(2-methylpropyl)urea |
| SMILES | COCCOc1ccc(NC(=O)N(CC(C)C)C[C@@H](O)c2ccc(F)cc2)cn1 |
| InChI | InChI=1S/C21H28FN3O4/c1-15(2)13-25(14-19(26)16-4-6-17(22)7-5-16)21(27)24-18-8-9-20(23-12-18)29-11-10-28-3/h4-9,12,15,19,26H,10-11,13-14H2,1-3H3,(H,24,27)/t19-/m1/s1 |
| InChIKey | FONAVWAJMJKYEU-LJQANCHMSA-N |
| XLogP | 3.47 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|