C8H10F2N2O2 — CID 122171540
3-[3-(difluoromethyl)-4-methylpyrazol-1-yl]propanoic acid (PubChem CID 122171540) has the molecular formula C8H10F2N2O2 and a molecular weight of 204.18 g/mol. Its IUPAC name is 3-[3-(difluoromethyl)-4-methylpyrazol-1-yl]propanoic acid.
| Compound Name | 3-[3-(difluoromethyl)-4-methylpyrazol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 122171540 |
| Molecular Formula | C8H10F2N2O2 |
| Molecular Weight | 204.18 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 3-[3-(difluoromethyl)-4-methylpyrazol-1-yl]propanoic acid |
| SMILES | Cc1cn(CCC(=O)O)nc1C(F)F |
| InChI | InChI=1S/C8H10F2N2O2/c1-5-4-12(3-2-6(13)14)11-7(5)8(9)10/h4,8H,2-3H2,1H3,(H,13,14) |
| InChIKey | IFWHJEZNCSMOEK-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.18 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |