C21H21ClN2O3 — CID 122174433
3-[2-(3-chloro-N-propylanilino)-2-oxoethyl]-1-methylindole-2-carboxylic acid (PubChem CID 122174433) has the molecular formula C21H21ClN2O3 and a molecular weight of 384.86 g/mol. Its IUPAC name is 3-[2-(3-chloro-N-propylanilino)-2-oxoethyl]-1-methylindole-2-carboxylic acid.
| Compound Name | 3-[2-(3-chloro-N-propylanilino)-2-oxoethyl]-1-methylindole-2-carboxylic acid |
|---|---|
| PubChem CID | 122174433 |
| Molecular Formula | C21H21ClN2O3 |
| Molecular Weight | 384.86 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 3-[2-(3-chloro-N-propylanilino)-2-oxoethyl]-1-methylindole-2-carboxylic acid |
| SMILES | CCCN(C(=O)Cc1c(C(=O)O)n(C)c2ccccc12)c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H21ClN2O3/c1-3-11-24(15-8-6-7-14(22)12-15)19(25)13-17-16-9-4-5-10-18(16)23(2)20(17)21(26)27/h4-10,12H,3,11,13H2,1-2H3,(H,26,27) |
| InChIKey | CNXAXUDGCIHSSL-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.86 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|