C20H19ClN2O3 — CID 54690848
N-butyl-N-(3-chlorophenyl)-4-hydroxy-2-oxo-1H-quinoline-3-carboxamide (PubChem CID 54690848) has the molecular formula C20H19ClN2O3 and a molecular weight of 370.84 g/mol. Its IUPAC name is N-butyl-N-(3-chlorophenyl)-4-hydroxy-2-oxo-1H-quinoline-3-carboxamide.
| Compound Name | N-butyl-N-(3-chlorophenyl)-4-hydroxy-2-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 54690848 |
| Molecular Formula | C20H19ClN2O3 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | N-butyl-N-(3-chlorophenyl)-4-hydroxy-2-oxo-1H-quinoline-3-carboxamide |
| SMILES | CCCCN(C(=O)c1c(O)c2ccccc2[nH]c1=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H19ClN2O3/c1-2-3-11-23(14-8-6-7-13(21)12-14)20(26)17-18(24)15-9-4-5-10-16(15)22-19(17)25/h4-10,12H,2-3,11H2,1H3,(H2,22,24,25) |
| InChIKey | NERDUYYXCZWRSK-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |