C16H24ClNO — CID 71106740
N-butyl-N-(3-chlorophenyl)-2,3-dimethylbutanamide (PubChem CID 71106740) has the molecular formula C16H24ClNO and a molecular weight of 281.83 g/mol. Its IUPAC name is N-butyl-N-(3-chlorophenyl)-2,3-dimethylbutanamide.
| Compound Name | N-butyl-N-(3-chlorophenyl)-2,3-dimethylbutanamide |
|---|---|
| PubChem CID | 71106740 |
| Molecular Formula | C16H24ClNO |
| Molecular Weight | 281.83 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | N-butyl-N-(3-chlorophenyl)-2,3-dimethylbutanamide |
| SMILES | CCCCN(C(=O)C(C)C(C)C)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H24ClNO/c1-5-6-10-18(16(19)13(4)12(2)3)15-9-7-8-14(17)11-15/h7-9,11-13H,5-6,10H2,1-4H3 |
| InChIKey | BRHKAHCXGJFRIP-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.83 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |