C21H21N3O3 — CID 122174668
methyl 3-(4-methylphenyl)-4-oxo-2-pyrrolidin-1-ylquinazoline-7-carboxylate (PubChem CID 122174668) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is methyl 3-(4-methylphenyl)-4-oxo-2-pyrrolidin-1-ylquinazoline-7-carboxylate.
| Compound Name | methyl 3-(4-methylphenyl)-4-oxo-2-pyrrolidin-1-ylquinazoline-7-carboxylate |
|---|---|
| PubChem CID | 122174668 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | methyl 3-(4-methylphenyl)-4-oxo-2-pyrrolidin-1-ylquinazoline-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(=O)n(-c3ccc(C)cc3)c(N3CCCC3)nc2c1 |
| InChI | InChI=1S/C21H21N3O3/c1-14-5-8-16(9-6-14)24-19(25)17-10-7-15(20(26)27-2)13-18(17)22-21(24)23-11-3-4-12-23/h5-10,13H,3-4,11-12H2,1-2H3 |
| InChIKey | OSWWIAFXCLLGIC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |