C21H20ClN3O3 — CID 50840933
methyl 3-(4-chlorophenyl)-4-oxo-2-piperidin-1-ylquinazoline-7-carboxylate (PubChem CID 50840933) has the molecular formula C21H20ClN3O3 and a molecular weight of 397.86 g/mol. Its IUPAC name is methyl 3-(4-chlorophenyl)-4-oxo-2-piperidin-1-ylquinazoline-7-carboxylate.
| Compound Name | methyl 3-(4-chlorophenyl)-4-oxo-2-piperidin-1-ylquinazoline-7-carboxylate |
|---|---|
| PubChem CID | 50840933 |
| Molecular Formula | C21H20ClN3O3 |
| Molecular Weight | 397.86 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | methyl 3-(4-chlorophenyl)-4-oxo-2-piperidin-1-ylquinazoline-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(=O)n(-c3ccc(Cl)cc3)c(N3CCCCC3)nc2c1 |
| InChI | InChI=1S/C21H20ClN3O3/c1-28-20(27)14-5-10-17-18(13-14)23-21(24-11-3-2-4-12-24)25(19(17)26)16-8-6-15(22)7-9-16/h5-10,13H,2-4,11-12H2,1H3 |
| InChIKey | FIFQOIGQVWHOBL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.86 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |