C22H22ClN3O3 — CID 53200415
methyl 3-(3-chlorophenyl)-2-(4-methylpiperidin-1-yl)-4-oxoquinazoline-7-carboxylate (PubChem CID 53200415) has the molecular formula C22H22ClN3O3 and a molecular weight of 411.89 g/mol. Its IUPAC name is methyl 3-(3-chlorophenyl)-2-(4-methylpiperidin-1-yl)-4-oxoquinazoline-7-carboxylate.
| Compound Name | methyl 3-(3-chlorophenyl)-2-(4-methylpiperidin-1-yl)-4-oxoquinazoline-7-carboxylate |
|---|---|
| PubChem CID | 53200415 |
| Molecular Formula | C22H22ClN3O3 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | methyl 3-(3-chlorophenyl)-2-(4-methylpiperidin-1-yl)-4-oxoquinazoline-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(=O)n(-c3cccc(Cl)c3)c(N3CCC(C)CC3)nc2c1 |
| InChI | InChI=1S/C22H22ClN3O3/c1-14-8-10-25(11-9-14)22-24-19-12-15(21(28)29-2)6-7-18(19)20(27)26(22)17-5-3-4-16(23)13-17/h3-7,12-14H,8-11H2,1-2H3 |
| InChIKey | HCNATLLKWIRLNZ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |